C8H13N3OS — CID 5192856
1-(cyclopropanecarbonylamino)-3-prop-2-enylthiourea (PubChem CID 5192856) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-(cyclopropanecarbonylamino)-3-prop-2-enylthiourea.
| Compound Name | 1-(cyclopropanecarbonylamino)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 5192856 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(cyclopropanecarbonylamino)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)C1CC1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-5-9-8(13)11-10-7(12)6-3-4-6/h2,6H,1,3-5H2,(H,10,12)(H2,9,11,13) |
| InChIKey | SVMGNZSWCFOLRA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|