C11H20N4O2S — CID 3132890
1-(3-morpholin-4-ylpropanoylamino)-3-prop-2-enylthiourea (PubChem CID 3132890) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropanoylamino)-3-prop-2-enylthiourea.
| Compound Name | 1-(3-morpholin-4-ylpropanoylamino)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3132890 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-(3-morpholin-4-ylpropanoylamino)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C11H20N4O2S/c1-2-4-12-11(18)14-13-10(16)3-5-15-6-8-17-9-7-15/h2H,1,3-9H2,(H,13,16)(H2,12,14,18) |
| InChIKey | QZKORPOAGPXXPQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|