C7H13N3O2S — CID 99965130
1-[[(2R)-2-hydroxypropanoyl]amino]-3-prop-2-enylthiourea (PubChem CID 99965130) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 1-[[(2R)-2-hydroxypropanoyl]amino]-3-prop-2-enylthiourea.
| Compound Name | 1-[[(2R)-2-hydroxypropanoyl]amino]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 99965130 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-[[(2R)-2-hydroxypropanoyl]amino]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNC(=O)[C@@H](C)O |
| InChI | InChI=1S/C7H13N3O2S/c1-3-4-8-7(13)10-9-6(12)5(2)11/h3,5,11H,1,4H2,2H3,(H,9,12)(H2,8,10,13)/t5-/m1/s1 |
| InChIKey | HZHHLBIFTROZJX-RXMQYKEDSA-N |
| XLogP | -0.95 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|