C33H25F5N2 — CID 177490548
(2Z)-3-methyl-2-[(3-methyl-2,3,4,5-tetrahydro-1H-benzo[g]indol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methylidene]-4,5-dihydrobenzo[g]indole (PubChem CID 177490548) has the molecular formula C33H25F5N2 and a molecular weight of 544.57 g/mol. Its IUPAC name is (2Z)-3-methyl-2-[(3-methyl-2,3,4,5-tetrahydro-1H-benzo[g]indol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methylidene]-4,5-dihydrobenzo[g]indole.
| Compound Name | (2Z)-3-methyl-2-[(3-methyl-2,3,4,5-tetrahydro-1H-benzo[g]indol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methylidene]-4,5-dihydrobenzo[g]indole |
|---|---|
| PubChem CID | 177490548 |
| Molecular Formula | C33H25F5N2 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | (2Z)-3-methyl-2-[(3-methyl-2,3,4,5-tetrahydro-1H-benzo[g]indol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methylidene]-4,5-dihydrobenzo[g]indole |
| SMILES | CC1=C2CCc3ccccc3C2=N/C1=C(/c1c(F)c(F)c(F)c(F)c1F)C1NC2=C(CCc3ccccc32)C1C |
| InChI | InChI=1S/C33H25F5N2/c1-15-19-13-11-17-7-3-5-9-21(17)32(19)39-30(15)24(23-25(34)27(36)29(38)28(37)26(23)35)31-16(2)20-14-12-18-8-4-6-10-22(18)33(20)40-31/h3-10,15,30,39H,11-14H2,1-2H3/b31-24- |
| InChIKey | IZXVPPQVRYYSEL-QLTSDVKISA-N |
| XLogP | 7.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|