C15H23NO5S — CID 177492476
2-[(1R)-1-butoxyethyl]-5-methoxy-N-methylsulfonylbenzamide (PubChem CID 177492476) has the molecular formula C15H23NO5S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[(1R)-1-butoxyethyl]-5-methoxy-N-methylsulfonylbenzamide.
| Compound Name | 2-[(1R)-1-butoxyethyl]-5-methoxy-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 177492476 |
| Molecular Formula | C15H23NO5S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[(1R)-1-butoxyethyl]-5-methoxy-N-methylsulfonylbenzamide |
| SMILES | CCCCO[C@H](C)c1ccc(OC)cc1C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C15H23NO5S/c1-5-6-9-21-11(2)13-8-7-12(20-3)10-14(13)15(17)16-22(4,18)19/h7-8,10-11H,5-6,9H2,1-4H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | YMSNTIQDOLSEGL-LLVKDONJSA-N |
| XLogP | 2.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|