C36H38Br2Si4 — CID 177493023
[3,8-dibromo-7-[dimethyl(2-phenylethynyl)silyl]-5,5,10,10-tetramethylsilanthren-2-yl]-dimethyl-(2-phenylethynyl)silane (PubChem CID 177493023) has the molecular formula C36H38Br2Si4 and a molecular weight of 742.85 g/mol. Its IUPAC name is [3,8-dibromo-7-[dimethyl(2-phenylethynyl)silyl]-5,5,10,10-tetramethylsilanthren-2-yl]-dimethyl-(2-phenylethynyl)silane.
| Compound Name | [3,8-dibromo-7-[dimethyl(2-phenylethynyl)silyl]-5,5,10,10-tetramethylsilanthren-2-yl]-dimethyl-(2-phenylethynyl)silane |
|---|---|
| PubChem CID | 177493023 |
| Molecular Formula | C36H38Br2Si4 |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 740.04 |
| IUPAC Name | [3,8-dibromo-7-[dimethyl(2-phenylethynyl)silyl]-5,5,10,10-tetramethylsilanthren-2-yl]-dimethyl-(2-phenylethynyl)silane |
| SMILES | C[Si](C)(C#Cc1ccccc1)c1cc2c(cc1Br)[Si](C)(C)c1cc([Si](C)(C)C#Cc3ccccc3)c(Br)cc1[Si]2(C)C |
| InChI | InChI=1S/C36H38Br2Si4/c1-39(2,21-19-27-15-11-9-12-16-27)31-25-35-33(23-29(31)37)42(7,8)36-26-32(30(38)24-34(36)41(35,5)6)40(3,4)22-20-28-17-13-10-14-18-28/h9-18,23-26H,1-8H3 |
| InChIKey | DOUYPXBRQVSVCN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|