C23H13FN2O2S — CID 177498150
1-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-2-phenylethane-1,2-dione (PubChem CID 177498150) has the molecular formula C23H13FN2O2S and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 177498150 |
| Molecular Formula | C23H13FN2O2S |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 1-[2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazol-1-yl]-2-phenylethane-1,2-dione |
| SMILES | O=C(C(=O)c1c(-c2ccc(F)cc2)nc2sc3ccccc3n12)c1ccccc1 |
| InChI | InChI=1S/C23H13FN2O2S/c24-16-12-10-14(11-13-16)19-20(22(28)21(27)15-6-2-1-3-7-15)26-17-8-4-5-9-18(17)29-23(26)25-19/h1-13H |
| InChIKey | WKICSWPNDFXJJK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|