C22H15N5OS — CID 67625173
N-[(2-phenylimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide (PubChem CID 67625173) has the molecular formula C22H15N5OS and a molecular weight of 397.46 g/mol. Its IUPAC name is N-[(2-phenylimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(2-phenylimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67625173 |
| Molecular Formula | C22H15N5OS |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[(2-phenylimidazo[2,1-b][1,3]benzothiazol-1-yl)methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(NN=Cc1c(-c2ccccc2)nc2sc3ccccc3n12)c1cccnc1 |
| InChI | InChI=1S/C22H15N5OS/c28-21(16-9-6-12-23-13-16)26-24-14-18-20(15-7-2-1-3-8-15)25-22-27(18)17-10-4-5-11-19(17)29-22/h1-14H,(H,26,28) |
| InChIKey | HQNZZZSHHCLBLU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|