C19H30OSi — CID 177499840
2-[[dimethyl(phenyl)silyl]methyl]-3-methylidene-2-propylhexanal (PubChem CID 177499840) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is 2-[[dimethyl(phenyl)silyl]methyl]-3-methylidene-2-propylhexanal.
| Compound Name | 2-[[dimethyl(phenyl)silyl]methyl]-3-methylidene-2-propylhexanal |
|---|---|
| PubChem CID | 177499840 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-[[dimethyl(phenyl)silyl]methyl]-3-methylidene-2-propylhexanal |
| SMILES | C=C(CCC)C(C=O)(CCC)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H30OSi/c1-6-11-17(3)19(15-20,14-7-2)16-21(4,5)18-12-9-8-10-13-18/h8-10,12-13,15H,3,6-7,11,14,16H2,1-2,4-5H3 |
| InChIKey | KIRZIBRQAKPEKF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|