C17H26OSi — CID 11254347
3-[3-[dimethyl(phenyl)silyl]prop-1-en-2-yl]hexanal (PubChem CID 11254347) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is 3-[3-[dimethyl(phenyl)silyl]prop-1-en-2-yl]hexanal.
| Compound Name | 3-[3-[dimethyl(phenyl)silyl]prop-1-en-2-yl]hexanal |
|---|---|
| PubChem CID | 11254347 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-[3-[dimethyl(phenyl)silyl]prop-1-en-2-yl]hexanal |
| SMILES | C=C(C[Si](C)(C)c1ccccc1)C(CC=O)CCC |
| InChI | InChI=1S/C17H26OSi/c1-5-9-16(12-13-18)15(2)14-19(3,4)17-10-7-6-8-11-17/h6-8,10-11,13,16H,2,5,9,12,14H2,1,3-4H3 |
| InChIKey | QXWOAXAZDDKFGR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|