C22H28OSi — CID 102172890
dimethyl-[2-methylidene-4-(3-methyloxiran-2-yl)-3-phenylbutyl]-phenylsilane (PubChem CID 102172890) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol. Its IUPAC name is dimethyl-[2-methylidene-4-(3-methyloxiran-2-yl)-3-phenylbutyl]-phenylsilane.
| Compound Name | dimethyl-[2-methylidene-4-(3-methyloxiran-2-yl)-3-phenylbutyl]-phenylsilane |
|---|---|
| PubChem CID | 102172890 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | dimethyl-[2-methylidene-4-(3-methyloxiran-2-yl)-3-phenylbutyl]-phenylsilane |
| SMILES | C=C(C[Si](C)(C)c1ccccc1)C(CC1OC1C)c1ccccc1 |
| InChI | InChI=1S/C22H28OSi/c1-17(16-24(3,4)20-13-9-6-10-14-20)21(15-22-18(2)23-22)19-11-7-5-8-12-19/h5-14,18,21-22H,1,15-16H2,2-4H3 |
| InChIKey | AZAMRPKDLGFQOP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|