C14H20Si — CID 11736076
hexa-1,2-dien-3-yl-dimethyl-phenylsilane (PubChem CID 11736076) has the molecular formula C14H20Si and a molecular weight of 216.40 g/mol. Its IUPAC name is hexa-1,2-dien-3-yl-dimethyl-phenylsilane.
| Compound Name | hexa-1,2-dien-3-yl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11736076 |
| Molecular Formula | C14H20Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | hexa-1,2-dien-3-yl-dimethyl-phenylsilane |
| SMILES | C=C=C(CCC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H20Si/c1-5-10-13(6-2)15(3,4)14-11-8-7-9-12-14/h7-9,11-12H,2,5,10H2,1,3-4H3 |
| InChIKey | BBJRQLBLIILUJV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|