C19H18F3N9O2 — CID 178000752
1-[(4R)-4-[(4-amino-6-fluoro-5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]-3,3-difluoropiperidin-1-yl]-2-hydroxyethanone (PubChem CID 178000752) has the molecular formula C19H18F3N9O2 and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-[(4R)-4-[(4-amino-6-fluoro-5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]-3,3-difluoropiperidin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[(4R)-4-[(4-amino-6-fluoro-5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]-3,3-difluoropiperidin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 178000752 |
| Molecular Formula | C19H18F3N9O2 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[(4R)-4-[(4-amino-6-fluoro-5-imidazo[1,2-b]pyridazin-6-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)amino]-3,3-difluoropiperidin-1-yl]-2-hydroxyethanone |
| SMILES | Nc1nc(N[C@@H]2CCN(C(=O)CO)CC2(F)F)nn2cc(F)c(-c3ccc4nccn4n3)c12 |
| InChI | InChI=1S/C19H18F3N9O2/c20-10-7-31-16(15(10)11-1-2-13-24-4-6-30(13)27-11)17(23)26-18(28-31)25-12-3-5-29(14(33)8-32)9-19(12,21)22/h1-2,4,6-7,12,32H,3,5,8-9H2,(H3,23,25,26,28)/t12-/m1/s1 |
| InChIKey | QFFYTDZJUVTWFF-GFCCVEGCSA-N |
| XLogP | 0.80 |
| TPSA | 138.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |