C29H40F6N8 — CID 171551491
2-N-[1-(3,3-difluorocyclobutyl)-3-fluoropiperidin-4-yl]-6-fluoro-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1,1-difluoropropane;ethane (PubChem CID 171551491) has the molecular formula C29H40F6N8 and a molecular weight of 614.68 g/mol. Its IUPAC name is 2-N-[1-(3,3-difluorocyclobutyl)-3-fluoropiperidin-4-yl]-6-fluoro-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1,1-difluoropropane;ethane.
| Compound Name | 2-N-[1-(3,3-difluorocyclobutyl)-3-fluoropiperidin-4-yl]-6-fluoro-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1,1-difluoropropane;ethane |
|---|---|
| PubChem CID | 171551491 |
| Molecular Formula | C29H40F6N8 |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | 2-N-[1-(3,3-difluorocyclobutyl)-3-fluoropiperidin-4-yl]-6-fluoro-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine;1,1-difluoropropane;ethane |
| SMILES | CC.CC(C)=Nc1ccc(-c2c(F)cn3nc(NC4CCN(C5CC(F)(F)C5)CC4F)nc(N)c23)nc1C.CCC(F)F |
| InChI | InChI=1S/C24H28F4N8.C3H6F2.C2H6/c1-12(2)30-17-4-5-19(31-13(17)3)20-16(26)11-36-21(20)22(29)33-23(34-36)32-18-6-7-35(10-15(18)25)14-8-24(27,28)9-14;1-2-3(4)5;1-2/h4-5,11,14-15,18H,6-10H2,1-3H3,(H3,29,32,33,34);3H,2H2,1H3;1-2H3 |
| InChIKey | BKGOGEGHOSGHIT-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|