C25H36F4N8 — CID 171550886
1,1-difluoropropane;1-ethyl-3,3-difluoropyrrolidine;4-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171550886) has the molecular formula C25H36F4N8 and a molecular weight of 524.61 g/mol. Its IUPAC name is 1,1-difluoropropane;1-ethyl-3,3-difluoropyrrolidine;4-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1,1-difluoropropane;1-ethyl-3,3-difluoropyrrolidine;4-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171550886 |
| Molecular Formula | C25H36F4N8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | 1,1-difluoropropane;1-ethyl-3,3-difluoropyrrolidine;4-N-methyl-5-[6-methyl-5-(propan-2-ylideneamino)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCC(F)F.CCN1CCC(F)(F)C1.CNc1nc(N)nn2ccc(-c3ccc(N=C(C)C)c(C)n3)c12 |
| InChI | InChI=1S/C16H19N7.C6H11F2N.C3H6F2/c1-9(2)19-12-5-6-13(20-10(12)3)11-7-8-23-14(11)15(18-4)21-16(17)22-23;1-2-9-4-3-6(7,8)5-9;1-2-3(4)5/h5-8H,1-4H3,(H3,17,18,21,22);2-5H2,1H3;3H,2H2,1H3 |
| InChIKey | PJAMOTCGJCQKED-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|