C26H37F4N9O — CID 178001072
1-[3,3-difluoro-4-[[4-(methylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone;1,2-difluoropropane;ethane (PubChem CID 178001072) has the molecular formula C26H37F4N9O and a molecular weight of 567.64 g/mol. Its IUPAC name is 1-[3,3-difluoro-4-[[4-(methylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone;1,2-difluoropropane;ethane.
| Compound Name | 1-[3,3-difluoro-4-[[4-(methylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone;1,2-difluoropropane;ethane |
|---|---|
| PubChem CID | 178001072 |
| Molecular Formula | C26H37F4N9O |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | 1-[3,3-difluoro-4-[[4-(methylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone;1,2-difluoropropane;ethane |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NC4CCN(C(C)=O)CC4(F)F)nc(NC)c23)nc1C.CC.CC(F)CF |
| InChI | InChI=1S/C21H25F2N9O.C3H6F2.C2H6/c1-12-15(29-25-4)5-6-16(26-12)14-7-10-32-18(14)19(24-3)28-20(30-32)27-17-8-9-31(13(2)33)11-21(17,22)23;1-3(5)2-4;1-2/h5-7,10,17H,8-9,11H2,1-4H3,(H2,24,27,28,30);3H,2H2,1H3;1-2H3/b29-25+;; |
| InChIKey | CMIORQDYRKQOLD-UAJPIOKXSA-N |
| XLogP | 5.86 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|