C24H34F3N9 — CID 178000739
1,1-difluoropropane;2-N-[[(3R)-3-fluoro-1-methylpiperidin-4-yl]methyl]-4-N-methyl-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 178000739) has the molecular formula C24H34F3N9 and a molecular weight of 505.59 g/mol. Its IUPAC name is 1,1-difluoropropane;2-N-[[(3R)-3-fluoro-1-methylpiperidin-4-yl]methyl]-4-N-methyl-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 1,1-difluoropropane;2-N-[[(3R)-3-fluoro-1-methylpiperidin-4-yl]methyl]-4-N-methyl-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 178000739 |
| Molecular Formula | C24H34F3N9 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 1,1-difluoropropane;2-N-[[(3R)-3-fluoro-1-methylpiperidin-4-yl]methyl]-4-N-methyl-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NCC4CCN(C)C[C@@H]4F)nc(NC)c23)nc1C.CCC(F)F |
| InChI | InChI=1S/C21H28FN9.C3H6F2/c1-13-17(28-24-3)5-6-18(26-13)15-8-10-31-19(15)20(23-2)27-21(29-31)25-11-14-7-9-30(4)12-16(14)22;1-2-3(4)5/h5-6,8,10,14,16H,7,9,11-12H2,1-4H3,(H2,23,25,27,29);3H,2H2,1H3/b28-24+;/t14?,16-;/m0./s1 |
| InChIKey | IHFLGEHKPNNTPS-ZZTAVTDUSA-N |
| XLogP | 5.22 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|