C25H34F3N9O4 — CID 178000931
1,1-difluoropropane;[[2-[[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]methanetriol (PubChem CID 178000931) has the molecular formula C25H34F3N9O4 and a molecular weight of 581.60 g/mol. Its IUPAC name is 1,1-difluoropropane;[[2-[[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]methanetriol.
| Compound Name | 1,1-difluoropropane;[[2-[[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]methanetriol |
|---|---|
| PubChem CID | 178000931 |
| Molecular Formula | C25H34F3N9O4 |
| Molecular Weight | 581.60 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | 1,1-difluoropropane;[[2-[[3-fluoro-1-(oxetan-3-yl)piperidin-4-yl]amino]-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]methanetriol |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NC4CCN(C5COC5)CC4F)nc(NC(O)(O)O)c23)nc1C.CCC(F)F |
| InChI | InChI=1S/C22H28FN9O4.C3H6F2/c1-12-16(29-24-2)3-4-17(25-12)14-5-8-32-19(14)20(28-22(33,34)35)27-21(30-32)26-18-6-7-31(9-15(18)23)13-10-36-11-13;1-2-3(4)5/h3-5,8,13,15,18,33-35H,6-7,9-11H2,1-2H3,(H2,26,27,28,30);3H,2H2,1H3/b29-24+; |
| InChIKey | KOUQSKUKKHWKOE-DHRMVMEWSA-N |
| XLogP | 2.70 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|