C28H42F2N8O — CID 178001196
4-[[4-(cyclopropylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol;1,1-difluoropropane;ethane (PubChem CID 178001196) has the molecular formula C28H42F2N8O and a molecular weight of 544.70 g/mol. Its IUPAC name is 4-[[4-(cyclopropylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol;1,1-difluoropropane;ethane.
| Compound Name | 4-[[4-(cyclopropylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol;1,1-difluoropropane;ethane |
|---|---|
| PubChem CID | 178001196 |
| Molecular Formula | C28H42F2N8O |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 4-[[4-(cyclopropylamino)-5-[6-methyl-5-(methyldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-1-methylcyclohexan-1-ol;1,1-difluoropropane;ethane |
| SMILES | C/N=N/c1ccc(-c2ccn3nc(NC4CCC(C)(O)CC4)nc(NC4CC4)c23)nc1C.CC.CCC(F)F |
| InChI | InChI=1S/C23H30N8O.C3H6F2.C2H6/c1-14-18(29-24-3)6-7-19(25-14)17-10-13-31-20(17)21(26-15-4-5-15)28-22(30-31)27-16-8-11-23(2,32)12-9-16;1-2-3(4)5;1-2/h6-7,10,13,15-16,32H,4-5,8-9,11-12H2,1-3H3,(H2,26,27,28,30);3H,2H2,1H3;1-2H3/b29-24+;; |
| InChIKey | XBLQSOQKBOOGOJ-KNPTUQFPSA-N |
| XLogP | 7.18 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|