C32H47F2N7S2 — CID 170643036
1,1-difluoropropane;3-[2-[[1-(1-methylcyclobutyl)piperidin-4-yl]amino]-5-[3-methyl-4-(methyldiazenyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol (PubChem CID 170643036) has the molecular formula C32H47F2N7S2 and a molecular weight of 631.91 g/mol. Its IUPAC name is 1,1-difluoropropane;3-[2-[[1-(1-methylcyclobutyl)piperidin-4-yl]amino]-5-[3-methyl-4-(methyldiazenyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol.
| Compound Name | 1,1-difluoropropane;3-[2-[[1-(1-methylcyclobutyl)piperidin-4-yl]amino]-5-[3-methyl-4-(methyldiazenyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol |
|---|---|
| PubChem CID | 170643036 |
| Molecular Formula | C32H47F2N7S2 |
| Molecular Weight | 631.91 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | 1,1-difluoropropane;3-[2-[[1-(1-methylcyclobutyl)piperidin-4-yl]amino]-5-[3-methyl-4-(methyldiazenyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]pentane-2,2-dithiol |
| SMILES | CCC(F)F.CCC(c1nc(NC2CCN(C3(C)CCC3)CC2)nn2ccc(-c3ccc(/N=N/C)c(C)c3)c12)C(C)(S)S |
| InChI | InChI=1S/C29H41N7S2.C3H6F2/c1-6-23(29(4,37)38)25-26-22(20-8-9-24(33-30-5)19(2)18-20)12-17-36(26)34-27(32-25)31-21-10-15-35(16-11-21)28(3)13-7-14-28;1-2-3(4)5/h8-9,12,17-18,21,23,37-38H,6-7,10-11,13-16H2,1-5H3,(H,31,34);3H,2H2,1H3/b33-30+; |
| InChIKey | LNIRSQCBYUSJMD-GIKWFPBXSA-N |
| XLogP | 8.97 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.91 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|