C18H24N8 — CID 178001138
4-N-ethyl-2-N-methyl-5-[6-methyl-5-(propan-2-yldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 178001138) has the molecular formula C18H24N8 and a molecular weight of 352.45 g/mol. Its IUPAC name is 4-N-ethyl-2-N-methyl-5-[6-methyl-5-(propan-2-yldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-methyl-5-[6-methyl-5-(propan-2-yldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 178001138 |
| Molecular Formula | C18H24N8 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 4-N-ethyl-2-N-methyl-5-[6-methyl-5-(propan-2-yldiazenyl)-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | CCNc1nc(NC)nn2ccc(-c3ccc(/N=N/C(C)C)c(C)n3)c12 |
| InChI | InChI=1S/C18H24N8/c1-6-20-17-16-13(9-10-26(16)25-18(19-5)22-17)15-8-7-14(12(4)21-15)24-23-11(2)3/h7-11H,6H2,1-5H3,(H2,19,20,22,25)/b24-23+ |
| InChIKey | GNQQWLREFWZWLD-WCWDXBQESA-N |
| XLogP | 4.07 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|