C13H13F2N9 — CID 178000930
5-[5-diazenyl-6-(difluoromethylamino)-2-pyridinyl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 178000930) has the molecular formula C13H13F2N9 and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-[5-diazenyl-6-(difluoromethylamino)-2-pyridinyl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[5-diazenyl-6-(difluoromethylamino)-2-pyridinyl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 178000930 |
| Molecular Formula | C13H13F2N9 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-[5-diazenyl-6-(difluoromethylamino)-2-pyridinyl]-4-N-methylpyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N)nc(NC)c23)nc1NC(F)F |
| InChI | InChI=1S/C13H13F2N9/c1-18-11-9-6(4-5-24(9)23-13(16)21-11)7-2-3-8(22-17)10(19-7)20-12(14)15/h2-5,12,17H,1H3,(H,19,20)(H3,16,18,21,23)/b22-17+ |
| InChIKey | FGCWQPUGLWUHFB-OQKWZONESA-N |
| XLogP | 2.71 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|