C14H15N7 — CID 171551277
5-[5-(ethylideneamino)-6-methyl-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine (PubChem CID 171551277) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-[5-(ethylideneamino)-6-methyl-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine.
| Compound Name | 5-[5-(ethylideneamino)-6-methyl-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
|---|---|
| PubChem CID | 171551277 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[5-(ethylideneamino)-6-methyl-2-pyridinyl]pyrrolo[2,1-f][1,2,4]triazine-2,4-diamine |
| SMILES | C/C=N/c1ccc(-c2ccn3nc(N)nc(N)c23)nc1C |
| InChI | InChI=1S/C14H15N7/c1-3-17-10-4-5-11(18-8(10)2)9-6-7-21-12(9)13(15)19-14(16)20-21/h3-7H,1-2H3,(H4,15,16,19,20)/b17-3+ |
| InChIKey | ODWCZLSXVQMCAS-IJUHEHPCSA-N |
| XLogP | 1.99 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|