C26H31F2N9O — CID 178000911
1-[(3S,4R)-3-fluoro-4-[[5-[3-(5-fluoropent-1-en-2-yl)-3,4-dihydropyrido[3,2-c]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone (PubChem CID 178000911) has the molecular formula C26H31F2N9O and a molecular weight of 523.59 g/mol. Its IUPAC name is 1-[(3S,4R)-3-fluoro-4-[[5-[3-(5-fluoropent-1-en-2-yl)-3,4-dihydropyrido[3,2-c]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3S,4R)-3-fluoro-4-[[5-[3-(5-fluoropent-1-en-2-yl)-3,4-dihydropyrido[3,2-c]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 178000911 |
| Molecular Formula | C26H31F2N9O |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 1-[(3S,4R)-3-fluoro-4-[[5-[3-(5-fluoropent-1-en-2-yl)-3,4-dihydropyrido[3,2-c]pyridazin-6-yl]-4-(methylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]piperidin-1-yl]ethanone |
| SMILES | C=C(CCCF)C1Cc2nc(-c3ccn4nc(N[C@@H]5CCN(C(C)=O)C[C@@H]5F)nc(NC)c34)ccc2N=N1 |
| InChI | InChI=1S/C26H31F2N9O/c1-15(5-4-10-27)22-13-23-21(33-34-22)7-6-19(30-23)17-8-12-37-24(17)25(29-3)32-26(35-37)31-20-9-11-36(16(2)38)14-18(20)28/h6-8,12,18,20,22H,1,4-5,9-11,13-14H2,2-3H3,(H2,29,31,32,35)/t18-,20+,22?/m0/s1 |
| InChIKey | WAVIDAKVQUZKOI-RUYIAYPLSA-N |
| XLogP | 4.52 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|