C24H23F3N6O2 — CID 170641837
1-[(3R,4S)-4-[[5-(5H-1-benzazepin-7-yl)-4-(difluoromethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone (PubChem CID 170641837) has the molecular formula C24H23F3N6O2 and a molecular weight of 484.48 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[5-(5H-1-benzazepin-7-yl)-4-(difluoromethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4S)-4-[[5-(5H-1-benzazepin-7-yl)-4-(difluoromethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 170641837 |
| Molecular Formula | C24H23F3N6O2 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 1-[(3R,4S)-4-[[5-(5H-1-benzazepin-7-yl)-4-(difluoromethoxy)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3-fluoropiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H](Nc2nc(OC(F)F)c3c(-c4ccc5c(c4)CC=CC=N5)ccn3n2)[C@H](F)C1 |
| InChI | InChI=1S/C24H23F3N6O2/c1-14(34)32-10-8-20(18(25)13-32)29-24-30-22(35-23(26)27)21-17(7-11-33(21)31-24)15-5-6-19-16(12-15)4-2-3-9-28-19/h2-3,5-7,9,11-12,18,20,23H,4,8,10,13H2,1H3,(H,29,31)/t18-,20+/m1/s1 |
| InChIKey | NJTDUBNLHZMYEF-QUCCMNQESA-N |
| XLogP | 4.18 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |