C18H16BrI2NO3 — CID 178002856
benzyl 4-(4-bromophenyl)-2,2-diiodo-1,3-oxazinane-3-carboxylate (PubChem CID 178002856) has the molecular formula C18H16BrI2NO3 and a molecular weight of 628.04 g/mol. Its IUPAC name is benzyl 4-(4-bromophenyl)-2,2-diiodo-1,3-oxazinane-3-carboxylate.
| Compound Name | benzyl 4-(4-bromophenyl)-2,2-diiodo-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 178002856 |
| Molecular Formula | C18H16BrI2NO3 |
| Molecular Weight | 628.04 g/mol |
| Exact Mass | 626.84 |
| IUPAC Name | benzyl 4-(4-bromophenyl)-2,2-diiodo-1,3-oxazinane-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C(c2ccc(Br)cc2)CCOC1(I)I |
| InChI | InChI=1S/C18H16BrI2NO3/c19-15-8-6-14(7-9-15)16-10-11-25-18(20,21)22(16)17(23)24-12-13-4-2-1-3-5-13/h1-9,16H,10-12H2 |
| InChIKey | RUAQGFZLDQXFMF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.04 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|