C22H35IN2O3S — CID 178004367
1-[3-(1-iodoethylsulfonyl)phenyl]-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-4-ol (PubChem CID 178004367) has the molecular formula C22H35IN2O3S and a molecular weight of 534.50 g/mol. Its IUPAC name is 1-[3-(1-iodoethylsulfonyl)phenyl]-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-4-ol.
| Compound Name | 1-[3-(1-iodoethylsulfonyl)phenyl]-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 178004367 |
| Molecular Formula | C22H35IN2O3S |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 1-[3-(1-iodoethylsulfonyl)phenyl]-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidin-4-ol |
| SMILES | CC(C)C1CCN(CC2(O)CCN(c3cccc(S(=O)(=O)C(C)I)c3)CC2)CC1 |
| InChI | InChI=1S/C22H35IN2O3S/c1-17(2)19-7-11-24(12-8-19)16-22(26)9-13-25(14-10-22)20-5-4-6-21(15-20)29(27,28)18(3)23/h4-6,15,17-19,26H,7-14,16H2,1-3H3 |
| InChIKey | PYLMCEJRDKCWQQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|