C22H39FN2O2S — CID 178004691
ethane;1-(2-fluoro-5-hydroxysulfanylphenyl)-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidine;hydrate (PubChem CID 178004691) has the molecular formula C22H39FN2O2S and a molecular weight of 414.63 g/mol. Its IUPAC name is ethane;1-(2-fluoro-5-hydroxysulfanylphenyl)-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidine;hydrate.
| Compound Name | ethane;1-(2-fluoro-5-hydroxysulfanylphenyl)-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidine;hydrate |
|---|---|
| PubChem CID | 178004691 |
| Molecular Formula | C22H39FN2O2S |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | ethane;1-(2-fluoro-5-hydroxysulfanylphenyl)-4-[(4-propan-2-ylpiperidin-1-yl)methyl]piperidine;hydrate |
| SMILES | CC.CC(C)C1CCN(CC2CCN(c3cc(SO)ccc3F)CC2)CC1.O |
| InChI | InChI=1S/C20H31FN2OS.C2H6.H2O/c1-15(2)17-7-9-22(10-8-17)14-16-5-11-23(12-6-16)20-13-18(25-24)3-4-19(20)21;1-2;/h3-4,13,15-17,24H,5-12,14H2,1-2H3;1-2H3;1H2 |
| InChIKey | XGVKSURUASVAKB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|