C9H17NO — CID 178006224
ethane;6-methyl-5-azaspiro[2.4]heptan-4-one (PubChem CID 178006224) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is ethane;6-methyl-5-azaspiro[2.4]heptan-4-one.
| Compound Name | ethane;6-methyl-5-azaspiro[2.4]heptan-4-one |
|---|---|
| PubChem CID | 178006224 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | ethane;6-methyl-5-azaspiro[2.4]heptan-4-one |
| SMILES | CC.CC1CC2(CC2)C(=O)N1 |
| InChI | InChI=1S/C7H11NO.C2H6/c1-5-4-7(2-3-7)6(9)8-5;1-2/h5H,2-4H2,1H3,(H,8,9);1-2H3 |
| InChIKey | CHCCWQBZOKIYIQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |