C14H19NO5 — CID 178007357
4-(aminomethyl)-2-(methoxymethyl)benzoic acid;prop-2-enyl formate (PubChem CID 178007357) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-(aminomethyl)-2-(methoxymethyl)benzoic acid;prop-2-enyl formate.
| Compound Name | 4-(aminomethyl)-2-(methoxymethyl)benzoic acid;prop-2-enyl formate |
|---|---|
| PubChem CID | 178007357 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-(aminomethyl)-2-(methoxymethyl)benzoic acid;prop-2-enyl formate |
| SMILES | C=CCOC=O.COCc1cc(CN)ccc1C(=O)O |
| InChI | InChI=1S/C10H13NO3.C4H6O2/c1-14-6-8-4-7(5-11)2-3-9(8)10(12)13;1-2-3-6-4-5/h2-4H,5-6,11H2,1H3,(H,12,13);2,4H,1,3H2 |
| InChIKey | DWERPPJEIYMXKQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|