C26H32F3N3O6 — CID 178008004
benzyl 5-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]pentanoate (PubChem CID 178008004) has the molecular formula C26H32F3N3O6 and a molecular weight of 539.55 g/mol. Its IUPAC name is benzyl 5-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]pentanoate.
| Compound Name | benzyl 5-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]pentanoate |
|---|---|
| PubChem CID | 178008004 |
| Molecular Formula | C26H32F3N3O6 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | benzyl 5-[[(3aR,4R,7S,7aR)-2,2-dimethyl-7-[[6-(trifluoromethyl)pyrazin-2-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy]pentanoate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2COCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H32F3N3O6/c1-25(2)37-23-18(31-21-13-30-12-20(32-21)26(27,28)29)15-35-19(24(23)38-25)16-34-11-7-6-10-22(33)36-14-17-8-4-3-5-9-17/h3-5,8-9,12-13,18-19,23-24H,6-7,10-11,14-16H2,1-2H3,(H,31,32)/t18-,19+,23+,24-/m0/s1 |
| InChIKey | SMBIRWGSHLCHAP-LUZMIZLMSA-N |
| XLogP | 4.13 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|