C16H26N2O — CID 178008260
3,5-dimethyl-4-(3-methylphenoxy)-1H-pyrazole;ethane (PubChem CID 178008260) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3-methylphenoxy)-1H-pyrazole;ethane.
| Compound Name | 3,5-dimethyl-4-(3-methylphenoxy)-1H-pyrazole;ethane |
|---|---|
| PubChem CID | 178008260 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3,5-dimethyl-4-(3-methylphenoxy)-1H-pyrazole;ethane |
| SMILES | CC.CC.Cc1cccc(Oc2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C12H14N2O.2C2H6/c1-8-5-4-6-11(7-8)15-12-9(2)13-14-10(12)3;2*1-2/h4-7H,1-3H3,(H,13,14);2*1-2H3 |
| InChIKey | YYEDRCWMLIGTQV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |