C15H21F4N3O2 — CID 178008323
(1R,2S,3R,4S,6S)-4-fluoro-3-(2-methylpropyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol (PubChem CID 178008323) has the molecular formula C15H21F4N3O2 and a molecular weight of 351.34 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S)-4-fluoro-3-(2-methylpropyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R,4S,6S)-4-fluoro-3-(2-methylpropyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 178008323 |
| Molecular Formula | C15H21F4N3O2 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1R,2S,3R,4S,6S)-4-fluoro-3-(2-methylpropyl)-6-[[6-(trifluoromethyl)pyrazin-2-yl]amino]cyclohexane-1,2-diol |
| SMILES | CC(C)C[C@@H]1[C@H](O)[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)C[C@@H]1F |
| InChI | InChI=1S/C15H21F4N3O2/c1-7(2)3-8-9(16)4-10(14(24)13(8)23)21-12-6-20-5-11(22-12)15(17,18)19/h5-10,13-14,23-24H,3-4H2,1-2H3,(H,21,22)/t8-,9-,10-,13-,14+/m0/s1 |
| InChIKey | JFDLBAZWHQQQMT-ZGAQPHEGSA-N |
| XLogP | 2.40 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |