C17H17N3O — CID 178009641
8-(2,3-dimethylphenyl)-5-methoxyquinazolin-4-amine (PubChem CID 178009641) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 8-(2,3-dimethylphenyl)-5-methoxyquinazolin-4-amine.
| Compound Name | 8-(2,3-dimethylphenyl)-5-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 178009641 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 8-(2,3-dimethylphenyl)-5-methoxyquinazolin-4-amine |
| SMILES | COc1ccc(-c2cccc(C)c2C)c2ncnc(N)c12 |
| InChI | InChI=1S/C17H17N3O/c1-10-5-4-6-12(11(10)2)13-7-8-14(21-3)15-16(13)19-9-20-17(15)18/h4-9H,1-3H3,(H2,18,19,20) |
| InChIKey | WNRCQBOVZCNZBV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |