C11H17NO — CID 178010950
N-[(E)-but-2-enyl]spiro[2.3]hexane-2-carboxamide (PubChem CID 178010950) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]spiro[2.3]hexane-2-carboxamide.
| Compound Name | N-[(E)-but-2-enyl]spiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 178010950 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(E)-but-2-enyl]spiro[2.3]hexane-2-carboxamide |
| SMILES | C/C=C/CNC(=O)C1CC12CCC2 |
| InChI | InChI=1S/C11H17NO/c1-2-3-7-12-10(13)9-8-11(9)5-4-6-11/h2-3,9H,4-8H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | BYFJZNQYMHECAR-NSCUHMNNSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|