C23H26F3N5O — CID 178011011
N-[3-[5-amino-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1-tert-butylpyrazole-4-carboxamide (PubChem CID 178011011) has the molecular formula C23H26F3N5O and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[3-[5-amino-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1-tert-butylpyrazole-4-carboxamide.
| Compound Name | N-[3-[5-amino-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1-tert-butylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 178011011 |
| Molecular Formula | C23H26F3N5O |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[3-[5-amino-1-(3,3,3-trifluoroprop-1-en-2-yl)isoquinolin-3-yl]propyl]-1-tert-butylpyrazole-4-carboxamide |
| SMILES | C=C(c1nc(CCCNC(=O)c2cnn(C(C)(C)C)c2)cc2c(N)cccc12)C(F)(F)F |
| InChI | InChI=1S/C23H26F3N5O/c1-14(23(24,25)26)20-17-8-5-9-19(27)18(17)11-16(30-20)7-6-10-28-21(32)15-12-29-31(13-15)22(2,3)4/h5,8-9,11-13H,1,6-7,10,27H2,2-4H3,(H,28,32) |
| InChIKey | VGGNRFILRFRBIL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|