C11H19N3O — CID 178011076
(2E)-N-[(E)-but-2-enyl]-2-(methylidenehydrazinylidene)but-3-enamide;ethane (PubChem CID 178011076) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is (2E)-N-[(E)-but-2-enyl]-2-(methylidenehydrazinylidene)but-3-enamide;ethane.
| Compound Name | (2E)-N-[(E)-but-2-enyl]-2-(methylidenehydrazinylidene)but-3-enamide;ethane |
|---|---|
| PubChem CID | 178011076 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (2E)-N-[(E)-but-2-enyl]-2-(methylidenehydrazinylidene)but-3-enamide;ethane |
| SMILES | C=C/C(=N\N=C)C(=O)NC/C=C/C.CC |
| InChI | InChI=1S/C9H13N3O.C2H6/c1-4-6-7-11-9(13)8(5-2)12-10-3;1-2/h4-6H,2-3,7H2,1H3,(H,11,13);1-2H3/b6-4+,12-8+; |
| InChIKey | FVNHYSMEBULFKR-XDSYWWANSA-N |
| XLogP | 1.95 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|