C13H13F2N3O2 — CID 178012626
7-cyclopropyl-3,8-difluoro-N-methoxy-N-methylpyrrolo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 178012626) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 7-cyclopropyl-3,8-difluoro-N-methoxy-N-methylpyrrolo[1,2-a]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopropyl-3,8-difluoro-N-methoxy-N-methylpyrrolo[1,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 178012626 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 7-cyclopropyl-3,8-difluoro-N-methoxy-N-methylpyrrolo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | CON(C)C(=O)c1c(C2CC2)c(F)c2ncc(F)cn12 |
| InChI | InChI=1S/C13H13F2N3O2/c1-17(20-2)13(19)11-9(7-3-4-7)10(15)12-16-5-8(14)6-18(11)12/h5-7H,3-4H2,1-2H3 |
| InChIKey | DJDSPGCENOWQEX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|