C26H27F2N8O+ — CID 178013343
[4-[(E)-[4-[1-(difluoromethyl)-7-[(1R)-1-pyridin-2-ylethoxy]benzimidazol-5-yl]-5-methyltriazol-1-ium-1-ylidene]methyl]cyclohexyl]cyanamide (PubChem CID 178013343) has the molecular formula C26H27F2N8O+ and a molecular weight of 505.55 g/mol. Its IUPAC name is [4-[(E)-[4-[1-(difluoromethyl)-7-[(1R)-1-pyridin-2-ylethoxy]benzimidazol-5-yl]-5-methyltriazol-1-ium-1-ylidene]methyl]cyclohexyl]cyanamide.
| Compound Name | [4-[(E)-[4-[1-(difluoromethyl)-7-[(1R)-1-pyridin-2-ylethoxy]benzimidazol-5-yl]-5-methyltriazol-1-ium-1-ylidene]methyl]cyclohexyl]cyanamide |
|---|---|
| PubChem CID | 178013343 |
| Molecular Formula | C26H27F2N8O+ |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | [4-[(E)-[4-[1-(difluoromethyl)-7-[(1R)-1-pyridin-2-ylethoxy]benzimidazol-5-yl]-5-methyltriazol-1-ium-1-ylidene]methyl]cyclohexyl]cyanamide |
| SMILES | CC1=C(c2cc(O[C@H](C)c3ccccn3)c3c(c2)ncn3C(F)F)N=N/[N+]1=C/C1CCC(NC#N)CC1 |
| InChI | InChI=1S/C26H27F2N8O/c1-16-24(33-34-36(16)13-18-6-8-20(9-7-18)31-14-29)19-11-22-25(35(15-32-22)26(27)28)23(12-19)37-17(2)21-5-3-4-10-30-21/h3-5,10-13,15,17-18,20,26,31H,6-9H2,1-2H3/q+1/b36-13+/t17-,18?,20?/m1/s1 |
| InChIKey | FEECFXFQMVUIOT-SOTBGQAOSA-N |
| XLogP | 5.75 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|