C10H6BrN3O — CID 178014535
2-(bromomethyl)-5-(1,3,4-oxadiazol-2-yl)benzonitrile (PubChem CID 178014535) has the molecular formula C10H6BrN3O and a molecular weight of 264.08 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(1,3,4-oxadiazol-2-yl)benzonitrile.
| Compound Name | 2-(bromomethyl)-5-(1,3,4-oxadiazol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 178014535 |
| Molecular Formula | C10H6BrN3O |
| Molecular Weight | 264.08 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 2-(bromomethyl)-5-(1,3,4-oxadiazol-2-yl)benzonitrile |
| SMILES | N#Cc1cc(-c2nnco2)ccc1CBr |
| InChI | InChI=1S/C10H6BrN3O/c11-4-8-2-1-7(3-9(8)5-12)10-14-13-6-15-10/h1-3,6H,4H2 |
| InChIKey | WHPUHPVWTAHBPN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.08 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|