C31H40N4O5 — CID 178015405
benzyl N-[4-[4-[[4-(2,6-dioxopiperidin-3-yl)oxyanilino]methyl]piperidin-1-yl]cyclohexyl]carbamate (PubChem CID 178015405) has the molecular formula C31H40N4O5 and a molecular weight of 548.68 g/mol. Its IUPAC name is benzyl N-[4-[4-[[4-(2,6-dioxopiperidin-3-yl)oxyanilino]methyl]piperidin-1-yl]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[4-[[4-(2,6-dioxopiperidin-3-yl)oxyanilino]methyl]piperidin-1-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 178015405 |
| Molecular Formula | C31H40N4O5 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | benzyl N-[4-[4-[[4-(2,6-dioxopiperidin-3-yl)oxyanilino]methyl]piperidin-1-yl]cyclohexyl]carbamate |
| SMILES | O=C1CCC(Oc2ccc(NCC3CCN(C4CCC(NC(=O)OCc5ccccc5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C31H40N4O5/c36-29-15-14-28(30(37)34-29)40-27-12-8-24(9-13-27)32-20-22-16-18-35(19-17-22)26-10-6-25(7-11-26)33-31(38)39-21-23-4-2-1-3-5-23/h1-5,8-9,12-13,22,25-26,28,32H,6-7,10-11,14-21H2,(H,33,38)(H,34,36,37) |
| InChIKey | QFNWQTIETKAXPP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|