C31H40N4O4 — CID 178015590
benzyl N-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)anilino]cyclohexyl]methyl]piperidin-1-yl]carbamate (PubChem CID 178015590) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is benzyl N-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)anilino]cyclohexyl]methyl]piperidin-1-yl]carbamate.
| Compound Name | benzyl N-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)anilino]cyclohexyl]methyl]piperidin-1-yl]carbamate |
|---|---|
| PubChem CID | 178015590 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | benzyl N-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)anilino]cyclohexyl]methyl]piperidin-1-yl]carbamate |
| SMILES | O=C1CCC(c2ccc(NC3CCC(CC4CCN(NC(=O)OCc5ccccc5)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C31H40N4O4/c36-29-15-14-28(30(37)33-29)25-8-12-27(13-9-25)32-26-10-6-22(7-11-26)20-23-16-18-35(19-17-23)34-31(38)39-21-24-4-2-1-3-5-24/h1-5,8-9,12-13,22-23,26,28,32H,6-7,10-11,14-21H2,(H,34,38)(H,33,36,37) |
| InChIKey | NREWLFWLLFLSPS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|