C26H27N7 — CID 178018487
7-[1-amino-3-[2-(dimethylamino)ethylimino]prop-1-en-2-yl]-N-(2-phenyl-4-pyridinyl)quinazolin-4-amine (PubChem CID 178018487) has the molecular formula C26H27N7 and a molecular weight of 437.55 g/mol. Its IUPAC name is 7-[1-amino-3-[2-(dimethylamino)ethylimino]prop-1-en-2-yl]-N-(2-phenyl-4-pyridinyl)quinazolin-4-amine.
| Compound Name | 7-[1-amino-3-[2-(dimethylamino)ethylimino]prop-1-en-2-yl]-N-(2-phenyl-4-pyridinyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 178018487 |
| Molecular Formula | C26H27N7 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 7-[1-amino-3-[2-(dimethylamino)ethylimino]prop-1-en-2-yl]-N-(2-phenyl-4-pyridinyl)quinazolin-4-amine |
| SMILES | CN(C)CC/N=C/C(=CN)c1ccc2c(Nc3ccnc(-c4ccccc4)c3)ncnc2c1 |
| InChI | InChI=1S/C26H27N7/c1-33(2)13-12-28-17-21(16-27)20-8-9-23-25(14-20)30-18-31-26(23)32-22-10-11-29-24(15-22)19-6-4-3-5-7-19/h3-11,14-18H,12-13,27H2,1-2H3,(H,29,30,31,32)/b21-16?,28-17+ |
| InChIKey | KERMGQAFZSFJFF-VEQFFQBFSA-N |
| XLogP | 4.37 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|