About 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile
4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile (PubChem CID 178021909) has the molecular formula C13H8N4O2S
and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile.
Molecular Properties
| Compound Name | 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile |
| PubChem CID | 178021909 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cnc3cccnc32)cc1 |
| InChI | InChI=1S/C13H8N4O2S/c14-8-10-3-5-11(6-4-10)20(18,19)17-9-16-12-2-1-7-15-13(12)17/h1-7,9H |
| InChIKey | DJGUQEPMVJUXSV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile?
The IUPAC name of 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile (CID 178021909) is 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile.
What is the SMILES notation for 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile?
The canonical SMILES for 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile is N#Cc1ccc(S(=O)(=O)n2cnc3cccnc32)cc1.
What is the InChIKey of 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile?
The InChIKey is DJGUQEPMVJUXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O2S/c14-8-10-3-5-11(6-4-10)20(18,19)17-9-16-12-2-1-7-15-13(12)17/h1-7,9H.
What are the key properties of 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile?
4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile has a molecular weight of 284.30 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile is sourced from PubChem (CID 178021909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).