C13H8N4O2S — CID 178021909
4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile (PubChem CID 178021909) has the molecular formula C13H8N4O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile.
| Compound Name | 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 178021909 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-imidazo[4,5-b]pyridin-3-ylsulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cnc3cccnc32)cc1 |
| InChI | InChI=1S/C13H8N4O2S/c14-8-10-3-5-11(6-4-10)20(18,19)17-9-16-12-2-1-7-15-13(12)17/h1-7,9H |
| InChIKey | DJGUQEPMVJUXSV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 88.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |