C10H13N5 — CID 178024186
(E,2S)-5-(1H-pyrazolo[3,4-b]pyrazin-5-yl)pent-4-en-2-amine (PubChem CID 178024186) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is (E,2S)-5-(1H-pyrazolo[3,4-b]pyrazin-5-yl)pent-4-en-2-amine.
| Compound Name | (E,2S)-5-(1H-pyrazolo[3,4-b]pyrazin-5-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 178024186 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (E,2S)-5-(1H-pyrazolo[3,4-b]pyrazin-5-yl)pent-4-en-2-amine |
| SMILES | C[C@H](N)C/C=C/c1cnc2[nH]ncc2n1 |
| InChI | InChI=1S/C10H13N5/c1-7(11)3-2-4-8-5-12-10-9(14-8)6-13-15-10/h2,4-7H,3,11H2,1H3,(H,12,13,15)/b4-2+/t7-/m0/s1 |
| InChIKey | HQTQXSMRHOFTAG-XBBYQOBLSA-N |
| XLogP | 1.10 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |