C26H37N5O — CID 178026071
(3aR,6aS)-2-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol (PubChem CID 178026071) has the molecular formula C26H37N5O and a molecular weight of 435.62 g/mol. Its IUPAC name is (3aR,6aS)-2-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol.
| Compound Name | (3aR,6aS)-2-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
|---|---|
| PubChem CID | 178026071 |
| Molecular Formula | C26H37N5O |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | (3aR,6aS)-2-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-ol |
| SMILES | CC(C)c1cnc(NC2CCN(c3ccc(CN4C[C@H]5CC(O)C[C@H]5C4)cc3)CC2)nc1 |
| InChI | InChI=1S/C26H37N5O/c1-18(2)22-13-27-26(28-14-22)29-23-7-9-31(10-8-23)24-5-3-19(4-6-24)15-30-16-20-11-25(32)12-21(20)17-30/h3-6,13-14,18,20-21,23,25,32H,7-12,15-17H2,1-2H3,(H,27,28,29)/t20-,21+,25? |
| InChIKey | ZRBGDVBQFSRILI-KEVCNVLYSA-N |
| XLogP | 3.88 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|