C36H45N7O4 — CID 178026112
3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;1-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]pyrrolidin-3-ol (PubChem CID 178026112) has the molecular formula C36H45N7O4 and a molecular weight of 639.80 g/mol. Its IUPAC name is 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;1-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]pyrrolidin-3-ol.
| Compound Name | 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;1-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 178026112 |
| Molecular Formula | C36H45N7O4 |
| Molecular Weight | 639.80 g/mol |
| Exact Mass | 639.35 |
| IUPAC Name | 3-(3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;1-[[4-[4-[(5-propan-2-ylpyrimidin-2-yl)amino]piperidin-1-yl]phenyl]methyl]pyrrolidin-3-ol |
| SMILES | CC(C)c1cnc(NC2CCN(c3ccc(CN4CCC(O)C4)cc3)CC2)nc1.O=C1CCC(N2Cc3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H33N5O.C13H12N2O3/c1-17(2)19-13-24-23(25-14-19)26-20-7-11-28(12-8-20)21-5-3-18(4-6-21)15-27-10-9-22(29)16-27;16-11-6-5-10(12(17)14-11)15-7-8-3-1-2-4-9(8)13(15)18/h3-6,13-14,17,20,22,29H,7-12,15-16H2,1-2H3,(H,24,25,26);1-4,10H,5-7H2,(H,14,16,17) |
| InChIKey | DLBLCHBAKUOGDT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|