C25H30N2O3 — CID 178027426
[4-(2-methoxy-5-prop-2-enylphenyl)-2-prop-2-enylphenyl] 4-methylpiperazine-1-carboxylate (PubChem CID 178027426) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is [4-(2-methoxy-5-prop-2-enylphenyl)-2-prop-2-enylphenyl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [4-(2-methoxy-5-prop-2-enylphenyl)-2-prop-2-enylphenyl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 178027426 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | [4-(2-methoxy-5-prop-2-enylphenyl)-2-prop-2-enylphenyl] 4-methylpiperazine-1-carboxylate |
| SMILES | C=CCc1ccc(OC)c(-c2ccc(OC(=O)N3CCN(C)CC3)c(CC=C)c2)c1 |
| InChI | InChI=1S/C25H30N2O3/c1-5-7-19-9-11-24(29-4)22(17-19)20-10-12-23(21(18-20)8-6-2)30-25(28)27-15-13-26(3)14-16-27/h5-6,9-12,17-18H,1-2,7-8,13-16H2,3-4H3 |
| InChIKey | KVEOOHFFLJAQFW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|