C28H19N3O3 — CID 178027847
1-[4-(4-isocyanatophenyl)phenyl]-3-[4-(4-methylphenyl)phenyl]-1,3-diazetidine-2,4-dione (PubChem CID 178027847) has the molecular formula C28H19N3O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 1-[4-(4-isocyanatophenyl)phenyl]-3-[4-(4-methylphenyl)phenyl]-1,3-diazetidine-2,4-dione.
| Compound Name | 1-[4-(4-isocyanatophenyl)phenyl]-3-[4-(4-methylphenyl)phenyl]-1,3-diazetidine-2,4-dione |
|---|---|
| PubChem CID | 178027847 |
| Molecular Formula | C28H19N3O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[4-(4-isocyanatophenyl)phenyl]-3-[4-(4-methylphenyl)phenyl]-1,3-diazetidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(N3C(=O)N(c4ccc(-c5ccc(N=C=O)cc5)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H19N3O3/c1-19-2-4-20(5-3-19)22-8-14-25(15-9-22)30-27(33)31(28(30)34)26-16-10-23(11-17-26)21-6-12-24(13-7-21)29-18-32/h2-17H,1H3 |
| InChIKey | IMKALCRXCJVOBQ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|