C18H11N5O2 — CID 165345791
2,4-bis(4-isocyanatophenyl)-6-methyl-1,3,5-triazine (PubChem CID 165345791) has the molecular formula C18H11N5O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2,4-bis(4-isocyanatophenyl)-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-bis(4-isocyanatophenyl)-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 165345791 |
| Molecular Formula | C18H11N5O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2,4-bis(4-isocyanatophenyl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccc(N=C=O)cc2)nc(-c2ccc(N=C=O)cc2)n1 |
| InChI | InChI=1S/C18H11N5O2/c1-12-21-17(13-2-6-15(7-3-13)19-10-24)23-18(22-12)14-4-8-16(9-5-14)20-11-25/h2-9H,1H3 |
| InChIKey | VKIGBASGIZSHCO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 97.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|